C22H17F2NO4 — CID 42963010
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-phenylphenoxy)acetate (PubChem CID 42963010) has the molecular formula C22H17F2NO4 and a molecular weight of 397.38 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-phenylphenoxy)acetate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 42963010 |
| Molecular Formula | C22H17F2NO4 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-phenylphenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccccc1-c1ccccc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H17F2NO4/c23-18-11-10-16(12-19(18)24)25-21(26)13-29-22(27)14-28-20-9-5-4-8-17(20)15-6-2-1-3-7-15/h1-12H,13-14H2,(H,25,26) |
| InChIKey | RDHZWESSDCTITM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |