C17H15ClF2N2O4 — CID 9103322
methyl 2-[[2-[3-chloro-4-(difluoromethoxy)anilino]acetyl]amino]benzoate (PubChem CID 9103322) has the molecular formula C17H15ClF2N2O4 and a molecular weight of 384.77 g/mol. Its IUPAC name is methyl 2-[[2-[3-chloro-4-(difluoromethoxy)anilino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-chloro-4-(difluoromethoxy)anilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9103322 |
| Molecular Formula | C17H15ClF2N2O4 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | methyl 2-[[2-[3-chloro-4-(difluoromethoxy)anilino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CNc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClF2N2O4/c1-25-16(24)11-4-2-3-5-13(11)22-15(23)9-21-10-6-7-14(12(18)8-10)26-17(19)20/h2-8,17,21H,9H2,1H3,(H,22,23) |
| InChIKey | YPRKSQQZPWQJTD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|