C16H14Cl2F2N2O3 — CID 31418500
N-(2,3-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide (PubChem CID 31418500) has the molecular formula C16H14Cl2F2N2O3 and a molecular weight of 391.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide |
|---|---|
| PubChem CID | 31418500 |
| Molecular Formula | C16H14Cl2F2N2O3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2cccc(Cl)c2Cl)cc1OC(F)F |
| InChI | InChI=1S/C16H14Cl2F2N2O3/c1-24-12-6-5-9(7-13(12)25-16(19)20)21-8-14(23)22-11-4-2-3-10(17)15(11)18/h2-7,16,21H,8H2,1H3,(H,22,23) |
| InChIKey | LYIFVCVOOMLJNO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|