C19H21F2N3O4 — CID 55565701
3-[[2-[3-(difluoromethoxy)-4-methoxyanilino]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 55565701) has the molecular formula C19H21F2N3O4 and a molecular weight of 393.39 g/mol. Its IUPAC name is 3-[[2-[3-(difluoromethoxy)-4-methoxyanilino]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[3-(difluoromethoxy)-4-methoxyanilino]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 55565701 |
| Molecular Formula | C19H21F2N3O4 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[[2-[3-(difluoromethoxy)-4-methoxyanilino]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(NCC(=O)Nc2cccc(C(=O)N(C)C)c2)cc1OC(F)F |
| InChI | InChI=1S/C19H21F2N3O4/c1-24(2)18(26)12-5-4-6-14(9-12)23-17(25)11-22-13-7-8-15(27-3)16(10-13)28-19(20)21/h4-10,19,22H,11H2,1-3H3,(H,23,25) |
| InChIKey | VCYDUPAAPZMQIU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|