C19H20ClF2N3O4 — CID 25332759
N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide (PubChem CID 25332759) has the molecular formula C19H20ClF2N3O4 and a molecular weight of 427.84 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide.
| Compound Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide |
|---|---|
| PubChem CID | 25332759 |
| Molecular Formula | C19H20ClF2N3O4 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-[3-(difluoromethoxy)-4-methoxyanilino]acetamide |
| SMILES | COc1ccc(NCC(=O)NCC(=O)Nc2cccc(Cl)c2C)cc1OC(F)F |
| InChI | InChI=1S/C19H20ClF2N3O4/c1-11-13(20)4-3-5-14(11)25-18(27)10-24-17(26)9-23-12-6-7-15(28-2)16(8-12)29-19(21)22/h3-8,19,23H,9-10H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | FPLGHGLFGAWQMA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|