C24H26ClF3N2O4 — CID 60594629
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide (PubChem CID 60594629) has the molecular formula C24H26ClF3N2O4 and a molecular weight of 498.93 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 60594629 |
| Molecular Formula | C24H26ClF3N2O4 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
| SMILES | COc1ccc(C(CNC(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H26ClF3N2O4/c1-32-21-7-5-17(14-22(21)33-2)20(30-9-11-34-12-10-30)15-29-23(31)8-4-16-3-6-19(25)18(13-16)24(26,27)28/h3-8,13-14,20H,9-12,15H2,1-2H3,(H,29,31)/b8-4+ |
| InChIKey | LTRNSKRZHNBNBN-XBXARRHUSA-N |
| XLogP | 4.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|