C20H26F3N5OS — CID 111011395
2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111011395) has the molecular formula C20H26F3N5OS and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111011395 |
| Molecular Formula | C20H26F3N5OS |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccnc(OCC(F)(F)F)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C20H26F3N5OS/c1-24-19(26-12-15-6-7-25-18(11-15)29-14-20(21,22)23)27-13-16(17-5-4-10-30-17)28-8-2-3-9-28/h4-7,10-11,16H,2-3,8-9,12-14H2,1H3,(H2,24,26,27) |
| InChIKey | VSZJXXMKSVDROB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|