C17H23F3IN5S2 — CID 111617836
2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617836) has the molecular formula C17H23F3IN5S2 and a molecular weight of 545.44 g/mol. Its IUPAC name is 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617836 |
| Molecular Formula | C17H23F3IN5S2 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(C(F)(F)F)cs1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C17H22F3N5S2.HI/c1-21-16(23-10-15-24-14(11-27-15)17(18,19)20)22-9-12(13-5-4-8-26-13)25-6-2-3-7-25;/h4-5,8,11-12H,2-3,6-7,9-10H2,1H3,(H2,21,22,23);1H |
| InChIKey | WMAJNSRKAJVPJX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|