C26H24ClN3OS — CID 146025285
N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 146025285) has the molecular formula C26H24ClN3OS and a molecular weight of 462.02 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 146025285 |
| Molecular Formula | C26H24ClN3OS |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCCC1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C26H24ClN3OS/c27-19-11-9-18(10-12-19)24(30-13-3-4-14-30)17-28-26(31)21-16-23(25-8-5-15-32-25)29-22-7-2-1-6-20(21)22/h1-2,5-12,15-16,24H,3-4,13-14,17H2,(H,28,31) |
| InChIKey | RCBRZIAWDSLDFA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |