C21H25BrN2O3 — CID 24625048
3-bromo-2,5-dimethoxy-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 24625048) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 3-bromo-2,5-dimethoxy-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 3-bromo-2,5-dimethoxy-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 24625048 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-bromo-2,5-dimethoxy-N-(2-phenyl-2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | COc1cc(Br)c(OC)c(C(=O)NCC(c2ccccc2)N2CCCC2)c1 |
| InChI | InChI=1S/C21H25BrN2O3/c1-26-16-12-17(20(27-2)18(22)13-16)21(25)23-14-19(24-10-6-7-11-24)15-8-4-3-5-9-15/h3-5,8-9,12-13,19H,6-7,10-11,14H2,1-2H3,(H,23,25) |
| InChIKey | YNVWJOSGEHHLPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |