C26H15N3O3S2 — CID 4155163
N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 4155163) has the molecular formula C26H15N3O3S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4155163 |
| Molecular Formula | C26H15N3O3S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2cc3ccccc3oc2=O)cs1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C26H15N3O3S2/c30-24(17-13-20(23-10-5-11-33-23)27-19-8-3-2-7-16(17)19)29-26-28-21(14-34-26)18-12-15-6-1-4-9-22(15)32-25(18)31/h1-14H,(H,28,29,30) |
| InChIKey | WWRKBMIIYXFPIA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|