C21H22FN5O4S — CID 55914939
5-ethyl-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 55914939) has the molecular formula C21H22FN5O4S and a molecular weight of 459.50 g/mol. Its IUPAC name is 5-ethyl-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | 5-ethyl-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55914939 |
| Molecular Formula | C21H22FN5O4S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 5-ethyl-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C21H22FN5O4S/c1-2-18-16(14-24-27(18)20-5-3-4-8-23-20)21(28)25-15-6-7-17(22)19(13-15)32(29,30)26-9-11-31-12-10-26/h3-8,13-14H,2,9-12H2,1H3,(H,25,28) |
| InChIKey | IKTCEBAKVQLZLA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |