C16H23N3O5S — CID 119790367
N-(3-methoxy-4-pyrrolidin-1-ylsulfonylphenyl)morpholine-2-carboxamide (PubChem CID 119790367) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(3-methoxy-4-pyrrolidin-1-ylsulfonylphenyl)morpholine-2-carboxamide.
| Compound Name | N-(3-methoxy-4-pyrrolidin-1-ylsulfonylphenyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119790367 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-(3-methoxy-4-pyrrolidin-1-ylsulfonylphenyl)morpholine-2-carboxamide |
| SMILES | COc1cc(NC(=O)C2CNCCO2)ccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C16H23N3O5S/c1-23-13-10-12(18-16(20)14-11-17-6-9-24-14)4-5-15(13)25(21,22)19-7-2-3-8-19/h4-5,10,14,17H,2-3,6-9,11H2,1H3,(H,18,20) |
| InChIKey | DTJCHLMMZWZBQA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |