C18H31Cl2N3O4 — CID 119865052
N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119865052) has the molecular formula C18H31Cl2N3O4 and a molecular weight of 424.37 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119865052 |
| Molecular Formula | C18H31Cl2N3O4 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[3-[2-(diethylamino)ethoxy]-4-methoxyphenyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CCOc1cc(NC(=O)C2CNCCO2)ccc1OC.Cl.Cl |
| InChI | InChI=1S/C18H29N3O4.2ClH/c1-4-21(5-2)9-11-25-16-12-14(6-7-15(16)23-3)20-18(22)17-13-19-8-10-24-17;;/h6-7,12,17,19H,4-5,8-11,13H2,1-3H3,(H,20,22);2*1H |
| InChIKey | DCIAKNAKUIRKLW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |