C22H19ClN4O4S2 — CID 89096409
4-chloro-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-nitrosobenzamide (PubChem CID 89096409) has the molecular formula C22H19ClN4O4S2 and a molecular weight of 503.01 g/mol. Its IUPAC name is 4-chloro-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-nitrosobenzamide.
| Compound Name | 4-chloro-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-nitrosobenzamide |
|---|---|
| PubChem CID | 89096409 |
| Molecular Formula | C22H19ClN4O4S2 |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 4-chloro-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-nitrosobenzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(Cl)c(N=O)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H19ClN4O4S2/c1-13-3-10-19(14(2)11-13)27-33(30,31)17-7-5-16(6-8-17)24-22(32)25-21(28)15-4-9-18(23)20(12-15)26-29/h3-12,27H,1-2H3,(H2,24,25,28,32) |
| InChIKey | UYYSLNIHRTUDEJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|