C25H26N2O4S2 — CID 157439791
N-[[4-[(2,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-(4-methylphenoxy)acetamide (PubChem CID 157439791) has the molecular formula C25H26N2O4S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[[4-[(2,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[[4-[(2,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 157439791 |
| Molecular Formula | C25H26N2O4S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[[4-[(2,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NC(=S)Nc2ccc(S(=O)(=O)Cc3ccc(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O4S2/c1-17-5-10-22(11-6-17)31-15-24(28)27-25(32)26-21-8-12-23(13-9-21)33(29,30)16-20-7-4-18(2)14-19(20)3/h4-14H,15-16H2,1-3H3,(H2,26,27,28,32) |
| InChIKey | NXMAOIQMNFOLIW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|