C18H17N2O4S- — CID 7283310
4-[[2-(3,5-dimethylphenoxy)acetyl]carbamothioylamino]benzoate (PubChem CID 7283310) has the molecular formula C18H17N2O4S- and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[[2-(3,5-dimethylphenoxy)acetyl]carbamothioylamino]benzoate.
| Compound Name | 4-[[2-(3,5-dimethylphenoxy)acetyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 7283310 |
| Molecular Formula | C18H17N2O4S- |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[[2-(3,5-dimethylphenoxy)acetyl]carbamothioylamino]benzoate |
| SMILES | Cc1cc(C)cc(OCC(=O)NC(=S)Nc2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-11-7-12(2)9-15(8-11)24-10-16(21)20-18(25)19-14-5-3-13(4-6-14)17(22)23/h3-9H,10H2,1-2H3,(H,22,23)(H2,19,20,21,25)/p-1 |
| InChIKey | FPJOVUQOSACWAE-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|