C22H27N3O3S — CID 3515885
2-(3,5-dimethylphenoxy)-N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]acetamide (PubChem CID 3515885) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3515885 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NC(=S)Nc2ccc(CN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H27N3O3S/c1-16-11-17(2)13-20(12-16)28-15-21(26)24-22(29)23-19-5-3-18(4-6-19)14-25-7-9-27-10-8-25/h3-6,11-13H,7-10,14-15H2,1-2H3,(H2,23,24,26,29) |
| InChIKey | IRIGFFMAVZMVEX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|