C18H18Cl2N2O4S — CID 78863315
N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 78863315) has the molecular formula C18H18Cl2N2O4S and a molecular weight of 429.33 g/mol. Its IUPAC name is N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 78863315 |
| Molecular Formula | C18H18Cl2N2O4S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1ccc(S(=O)(=O)NCC2CC2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O4S/c19-13-3-8-17(16(20)9-13)26-11-18(23)22-14-4-6-15(7-5-14)27(24,25)21-10-12-1-2-12/h3-9,12,21H,1-2,10-11H2,(H,22,23) |
| InChIKey | AQFNIEFNPQPJIN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |