C23H20N2O6S — CID 24604937
(E)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-enamide (PubChem CID 24604937) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is (E)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24604937 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (E)-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-3-(7-methoxy-1-benzofuran-2-yl)prop-2-enamide |
| SMILES | COc1cccc2cc(/C=C/C(=O)Nc3cccc(S(=O)(=O)NCc4ccco4)c3)oc12 |
| InChI | InChI=1S/C23H20N2O6S/c1-29-21-9-2-5-16-13-18(31-23(16)21)10-11-22(26)25-17-6-3-8-20(14-17)32(27,28)24-15-19-7-4-12-30-19/h2-14,24H,15H2,1H3,(H,25,26)/b11-10+ |
| InChIKey | KKJICTBMCOSNIM-ZHACJKMWSA-N |
| XLogP | 4.16 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|