C26H28N2O6S — CID 26818010
4-[(E)-3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 26818010) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[(E)-3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-[(E)-3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26818010 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[(E)-3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2C(=O)/C=C/c2ccc(S(=O)(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C26H28N2O6S/c1-32-20-10-13-25(33-2)23(17-20)24-6-3-15-28(24)26(29)14-9-19-7-11-22(12-8-19)35(30,31)27-18-21-5-4-16-34-21/h4-5,7-14,16-17,24,27H,3,6,15,18H2,1-2H3/b14-9+/t24-/m1/s1 |
| InChIKey | LFORYICAGGQEGC-NNALFKCQSA-N |
| XLogP | 4.15 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|