C12H22ClN3O3S2 — CID 119668329
N-(1-aminohexan-2-yl)-4-(methylsulfamoyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119668329) has the molecular formula C12H22ClN3O3S2 and a molecular weight of 355.91 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-(methylsulfamoyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-(methylsulfamoyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119668329 |
| Molecular Formula | C12H22ClN3O3S2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-(methylsulfamoyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1cc(S(=O)(=O)NC)cs1.Cl |
| InChI | InChI=1S/C12H21N3O3S2.ClH/c1-3-4-5-9(7-13)15-12(16)11-6-10(8-19-11)20(17,18)14-2;/h6,8-9,14H,3-5,7,13H2,1-2H3,(H,15,16);1H |
| InChIKey | UPRKSSFQDMVPGZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |