C15H9N3O3S — CID 15836222
N-[5-(3,6-dioxocyclohexa-1,4-dien-1-yl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 15836222) has the molecular formula C15H9N3O3S and a molecular weight of 311.32 g/mol. Its IUPAC name is N-[5-(3,6-dioxocyclohexa-1,4-dien-1-yl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-(3,6-dioxocyclohexa-1,4-dien-1-yl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 15836222 |
| Molecular Formula | C15H9N3O3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[5-(3,6-dioxocyclohexa-1,4-dien-1-yl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C1C=CC(=O)C(c2nnc(NC(=O)c3ccccc3)s2)=C1 |
| InChI | InChI=1S/C15H9N3O3S/c19-10-6-7-12(20)11(8-10)14-17-18-15(22-14)16-13(21)9-4-2-1-3-5-9/h1-8H,(H,16,18,21) |
| InChIKey | TZNWGTJVYDNBAW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|