C17H14N4O2S — CID 19256575
N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzamide (PubChem CID 19256575) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 19256575 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H14N4O2S/c22-14(11-18-15(23)12-7-3-1-4-8-12)19-17-21-20-16(24-17)13-9-5-2-6-10-13/h1-10H,11H2,(H,18,23)(H,19,21,22) |
| InChIKey | BDLKCSUZVYPPNS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |