C23H18N4O2S — CID 55438240
N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]-4-phenylbenzamide (PubChem CID 55438240) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]-4-phenylbenzamide.
| Compound Name | N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 55438240 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]ethyl]-4-phenylbenzamide |
| SMILES | O=C(CNC(=O)c1ccc(-c2ccccc2)cc1)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C23H18N4O2S/c28-20(25-23-27-26-22(30-23)19-9-5-2-6-10-19)15-24-21(29)18-13-11-17(12-14-18)16-7-3-1-4-8-16/h1-14H,15H2,(H,24,29)(H,25,27,28) |
| InChIKey | RYMAYEJQPPZIAP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |