C16H15N5O3S2 — CID 25231506
ethyl 2,4-diamino-5-(5-benzamido-1,3,4-thiadiazol-2-yl)thiophene-3-carboxylate (PubChem CID 25231506) has the molecular formula C16H15N5O3S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is ethyl 2,4-diamino-5-(5-benzamido-1,3,4-thiadiazol-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2,4-diamino-5-(5-benzamido-1,3,4-thiadiazol-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 25231506 |
| Molecular Formula | C16H15N5O3S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | ethyl 2,4-diamino-5-(5-benzamido-1,3,4-thiadiazol-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(-c2nnc(NC(=O)c3ccccc3)s2)c1N |
| InChI | InChI=1S/C16H15N5O3S2/c1-2-24-15(23)9-10(17)11(25-12(9)18)14-20-21-16(26-14)19-13(22)8-6-4-3-5-7-8/h3-7H,2,17-18H2,1H3,(H,19,21,22) |
| InChIKey | GNYCEYFLEOTWPC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|