C16H11ClN4O3S — CID 56657925
6-chloro-N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide (PubChem CID 56657925) has the molecular formula C16H11ClN4O3S and a molecular weight of 374.81 g/mol. Its IUPAC name is 6-chloro-N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56657925 |
| Molecular Formula | C16H11ClN4O3S |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 6-chloro-N-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccc3c(c2)OCCO3)s1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H11ClN4O3S/c17-13-4-2-10(8-18-13)14(22)19-16-21-20-15(25-16)9-1-3-11-12(7-9)24-6-5-23-11/h1-4,7-8H,5-6H2,(H,19,21,22) |
| InChIKey | PYGRVEHCWINBCC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|