C16H14Cl2FNO2 — CID 2916938
2-(2,4-dichlorophenoxy)-N-(3-fluoro-2-methylphenyl)propanamide (PubChem CID 2916938) has the molecular formula C16H14Cl2FNO2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(3-fluoro-2-methylphenyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(3-fluoro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 2916938 |
| Molecular Formula | C16H14Cl2FNO2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(3-fluoro-2-methylphenyl)propanamide |
| SMILES | Cc1c(F)cccc1NC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO2/c1-9-13(19)4-3-5-14(9)20-16(21)10(2)22-15-7-6-11(17)8-12(15)18/h3-8,10H,1-2H3,(H,20,21) |
| InChIKey | OFGVUGPAMUIZSE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |