C22H19BrClNO3 — CID 17142159
2-(4-bromo-2-chlorophenoxy)-N-[3-(2-phenylethoxy)phenyl]acetamide (PubChem CID 17142159) has the molecular formula C22H19BrClNO3 and a molecular weight of 460.76 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[3-(2-phenylethoxy)phenyl]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[3-(2-phenylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17142159 |
| Molecular Formula | C22H19BrClNO3 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[3-(2-phenylethoxy)phenyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Cl)Nc1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C22H19BrClNO3/c23-17-9-10-21(20(24)13-17)28-15-22(26)25-18-7-4-8-19(14-18)27-12-11-16-5-2-1-3-6-16/h1-10,13-14H,11-12,15H2,(H,25,26) |
| InChIKey | MPBRWOKTZRWSMY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |