C27H22Br2N2O4 — CID 19628301
N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-2-(2-phenylethoxy)benzohydrazide (PubChem CID 19628301) has the molecular formula C27H22Br2N2O4 and a molecular weight of 598.29 g/mol. Its IUPAC name is N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-2-(2-phenylethoxy)benzohydrazide.
| Compound Name | N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-2-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 19628301 |
| Molecular Formula | C27H22Br2N2O4 |
| Molecular Weight | 598.29 g/mol |
| Exact Mass | 595.99 |
| IUPAC Name | N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-2-(2-phenylethoxy)benzohydrazide |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1Br)NNC(=O)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C27H22Br2N2O4/c28-20-11-12-21-19(16-20)10-13-24(26(21)29)35-17-25(32)30-31-27(33)22-8-4-5-9-23(22)34-15-14-18-6-2-1-3-7-18/h1-13,16H,14-15,17H2,(H,30,32)(H,31,33) |
| InChIKey | HWHVLTGIIKTUDM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|