C21H21N3O5S — CID 6234490
ethyl (E)-4-oxo-4-[[(2-phenylmethoxybenzoyl)amino]carbamothioylamino]but-2-enoate (PubChem CID 6234490) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-[[(2-phenylmethoxybenzoyl)amino]carbamothioylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-[[(2-phenylmethoxybenzoyl)amino]carbamothioylamino]but-2-enoate |
|---|---|
| PubChem CID | 6234490 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | ethyl (E)-4-oxo-4-[[(2-phenylmethoxybenzoyl)amino]carbamothioylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)NNC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-2-28-19(26)13-12-18(25)22-21(30)24-23-20(27)16-10-6-7-11-17(16)29-14-15-8-4-3-5-9-15/h3-13H,2,14H2,1H3,(H,23,27)(H2,22,24,25,30)/b13-12+ |
| InChIKey | FMGNORISTANQSC-OUKQBFOZSA-N |
| XLogP | 2.02 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|