C20H13Cl2IN2O2S — CID 3426666
N-[(2-chloro-4-iodophenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3426666) has the molecular formula C20H13Cl2IN2O2S and a molecular weight of 543.21 g/mol. Its IUPAC name is N-[(2-chloro-4-iodophenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[(2-chloro-4-iodophenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3426666 |
| Molecular Formula | C20H13Cl2IN2O2S |
| Molecular Weight | 543.21 g/mol |
| Exact Mass | 541.91 |
| IUPAC Name | N-[(2-chloro-4-iodophenyl)carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C20H13Cl2IN2O2S/c21-13-3-1-12(2-4-13)18-9-6-15(27-18)7-10-19(26)25-20(28)24-17-8-5-14(23)11-16(17)22/h1-11H,(H2,24,25,26,28) |
| InChIKey | TWZNBEONDQVHJR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.21 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|