C18H12ClIN2O2 — CID 17110766
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-(5-iodo-2-pyridinyl)prop-2-enamide (PubChem CID 17110766) has the molecular formula C18H12ClIN2O2 and a molecular weight of 450.66 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-(5-iodo-2-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-(5-iodo-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 17110766 |
| Molecular Formula | C18H12ClIN2O2 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-(5-iodo-2-pyridinyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2)o1)Nc1ccc(I)cn1 |
| InChI | InChI=1S/C18H12ClIN2O2/c19-13-3-1-12(2-4-13)16-8-6-15(24-16)7-10-18(23)22-17-9-5-14(20)11-21-17/h1-11H,(H,21,22,23)/b10-7+ |
| InChIKey | JPKUEHHPKWUULF-JXMROGBWSA-N |
| XLogP | 5.25 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|