C22H16F3NO5 — CID 28686510
2-hydroxy-3-methyl-5-[[(E)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]amino]benzoic acid (PubChem CID 28686510) has the molecular formula C22H16F3NO5 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-5-[[(E)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-3-methyl-5-[[(E)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 28686510 |
| Molecular Formula | C22H16F3NO5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-hydroxy-3-methyl-5-[[(E)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C22H16F3NO5/c1-12-9-15(11-17(20(12)28)21(29)30)26-19(27)8-6-16-5-7-18(31-16)13-3-2-4-14(10-13)22(23,24)25/h2-11,28H,1H3,(H,26,27)(H,29,30)/b8-6+ |
| InChIKey | XDXULRPXLKUCRG-SOFGYWHQSA-N |
| XLogP | 5.33 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|