C20H14FNO5 — CID 28678237
4-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-hydroxybenzoic acid (PubChem CID 28678237) has the molecular formula C20H14FNO5 and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 28678237 |
| Molecular Formula | C20H14FNO5 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(F)cc2)o1)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C20H14FNO5/c21-13-3-1-12(2-4-13)18-9-6-15(27-18)7-10-19(24)22-14-5-8-16(20(25)26)17(23)11-14/h1-11,23H,(H,22,24)(H,25,26)/b10-7+ |
| InChIKey | TVQZCXRMCTYWCM-JXMROGBWSA-N |
| XLogP | 4.14 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|