C19H14BrFN2O2 — CID 100828766
(E)-N-(4-amino-2-bromophenyl)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 100828766) has the molecular formula C19H14BrFN2O2 and a molecular weight of 401.24 g/mol. Its IUPAC name is (E)-N-(4-amino-2-bromophenyl)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4-amino-2-bromophenyl)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 100828766 |
| Molecular Formula | C19H14BrFN2O2 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (E)-N-(4-amino-2-bromophenyl)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Nc1ccc(NC(=O)/C=C/c2ccc(-c3ccc(F)cc3)o2)c(Br)c1 |
| InChI | InChI=1S/C19H14BrFN2O2/c20-16-11-14(22)5-8-17(16)23-19(24)10-7-15-6-9-18(25-15)12-1-3-13(21)4-2-12/h1-11H,22H2,(H,23,24)/b10-7+ |
| InChIKey | NAGDOCYBNFGACY-JXMROGBWSA-N |
| XLogP | 5.08 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|