C20H16BrClN2O3 — CID 100828804
(E)-N-(4-amino-2-bromophenyl)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]prop-2-enamide (PubChem CID 100828804) has the molecular formula C20H16BrClN2O3 and a molecular weight of 447.72 g/mol. Its IUPAC name is (E)-N-(4-amino-2-bromophenyl)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4-amino-2-bromophenyl)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 100828804 |
| Molecular Formula | C20H16BrClN2O3 |
| Molecular Weight | 447.72 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (E)-N-(4-amino-2-bromophenyl)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2ccc(/C=C/C(=O)Nc3ccc(N)cc3Br)o2)cc1Cl |
| InChI | InChI=1S/C20H16BrClN2O3/c1-26-19-7-2-12(10-16(19)22)18-8-4-14(27-18)5-9-20(25)24-17-6-3-13(23)11-15(17)21/h2-11H,23H2,1H3,(H,24,25)/b9-5+ |
| InChIKey | NGNJLVZEOPNVDN-WEVVVXLNSA-N |
| XLogP | 5.61 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|