C19H19NO7 — CID 4892827
4-[3-[5-(3-ethoxy-3-oxopropyl)furan-2-yl]prop-2-enoylamino]-2-hydroxybenzoic acid (PubChem CID 4892827) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is 4-[3-[5-(3-ethoxy-3-oxopropyl)furan-2-yl]prop-2-enoylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-[5-(3-ethoxy-3-oxopropyl)furan-2-yl]prop-2-enoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4892827 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[3-[5-(3-ethoxy-3-oxopropyl)furan-2-yl]prop-2-enoylamino]-2-hydroxybenzoic acid |
| SMILES | CCOC(=O)CCc1ccc(C=CC(=O)Nc2ccc(C(=O)O)c(O)c2)o1 |
| InChI | InChI=1S/C19H19NO7/c1-2-26-18(23)10-7-14-5-4-13(27-14)6-9-17(22)20-12-3-8-15(19(24)25)16(21)11-12/h3-6,8-9,11,21H,2,7,10H2,1H3,(H,20,22)(H,24,25) |
| InChIKey | DAXPVTGUCBIHRY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|