C22H16N6O5S — CID 17163093
N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-(4-methyl-2-nitrophenyl)furan-2-carboxamide (PubChem CID 17163093) has the molecular formula C22H16N6O5S and a molecular weight of 476.47 g/mol. Its IUPAC name is N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-(4-methyl-2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-(4-methyl-2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17163093 |
| Molecular Formula | C22H16N6O5S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-5-(4-methyl-2-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-c2nn3cnnc3s2)cc1NC(=O)c1ccc(-c2ccc(C)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C22H16N6O5S/c1-12-3-5-14(16(9-12)28(30)31)17-7-8-19(33-17)20(29)24-15-10-13(4-6-18(15)32-2)21-26-27-11-23-25-22(27)34-21/h3-11H,1-2H3,(H,24,29) |
| InChIKey | QNMUDGJIGRSIQC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|