C17H12IN5O2S — CID 17162983
4-iodo-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide (PubChem CID 17162983) has the molecular formula C17H12IN5O2S and a molecular weight of 477.29 g/mol. Its IUPAC name is 4-iodo-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide.
| Compound Name | 4-iodo-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17162983 |
| Molecular Formula | C17H12IN5O2S |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | 4-iodo-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
| SMILES | COc1ccc(-c2nn3cnnc3s2)cc1NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H12IN5O2S/c1-25-14-7-4-11(16-22-23-9-19-21-17(23)26-16)8-13(14)20-15(24)10-2-5-12(18)6-3-10/h2-9H,1H3,(H,20,24) |
| InChIKey | WRGKDMMREAWLAI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|