C24H15BrN2O3 — CID 1109866
N-[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 1109866) has the molecular formula C24H15BrN2O3 and a molecular weight of 459.30 g/mol. Its IUPAC name is N-[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1109866 |
| Molecular Formula | C24H15BrN2O3 |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-[2-(5-bromonaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)Nc1ccc2oc(-c3cccc4c(Br)cccc34)nc2c1 |
| InChI | InChI=1S/C24H15BrN2O3/c25-20-8-2-5-17-18(20)6-1-7-19(17)24-27-21-14-15(9-11-22(21)30-24)26-23(28)12-10-16-4-3-13-29-16/h1-14H,(H,26,28) |
| InChIKey | CQYKWSJSXCOFIP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|