C30H34N2O3 — CID 4633917
N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-4-hexoxybenzamide (PubChem CID 4633917) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-4-hexoxybenzamide.
| Compound Name | N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4633917 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(-c3nc4cc(C(C)CC)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C30H34N2O3/c1-4-6-7-8-19-34-26-16-11-22(12-17-26)29(33)31-25-14-9-23(10-15-25)30-32-27-20-24(21(3)5-2)13-18-28(27)35-30/h9-18,20-21H,4-8,19H2,1-3H3,(H,31,33) |
| InChIKey | WFESHXQKNUSIQZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|