C24H21BrN2O4 — CID 3399049
N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-butoxybenzamide (PubChem CID 3399049) has the molecular formula C24H21BrN2O4 and a molecular weight of 481.35 g/mol. Its IUPAC name is N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-butoxybenzamide.
| Compound Name | N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 3399049 |
| Molecular Formula | C24H21BrN2O4 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc3oc(-c4ccc(O)c(Br)c4)nc3c2)cc1 |
| InChI | InChI=1S/C24H21BrN2O4/c1-2-3-12-30-18-8-4-15(5-9-18)23(29)26-17-7-11-22-20(14-17)27-24(31-22)16-6-10-21(28)19(25)13-16/h4-11,13-14,28H,2-3,12H2,1H3,(H,26,29) |
| InChIKey | HOODQBZGYVOJSG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|