C26H25BrN2O3 — CID 17162837
N-[4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-butoxybenzamide (PubChem CID 17162837) has the molecular formula C26H25BrN2O3 and a molecular weight of 493.40 g/mol. Its IUPAC name is N-[4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-butoxybenzamide.
| Compound Name | N-[4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 17162837 |
| Molecular Formula | C26H25BrN2O3 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-[4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(-c3nc4cc(CC)cc(Br)c4o3)cc2)cc1 |
| InChI | InChI=1S/C26H25BrN2O3/c1-3-5-14-31-21-12-8-18(9-13-21)25(30)28-20-10-6-19(7-11-20)26-29-23-16-17(4-2)15-22(27)24(23)32-26/h6-13,15-16H,3-5,14H2,1-2H3,(H,28,30) |
| InChIKey | BQLMAHATYAVOPM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|