C18H22N2O2S — CID 3327394
4,6-dimethyl-2-[4-(oxan-2-ylmethoxy)phenyl]sulfanylpyrimidine (PubChem CID 3327394) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 4,6-dimethyl-2-[4-(oxan-2-ylmethoxy)phenyl]sulfanylpyrimidine.
| Compound Name | 4,6-dimethyl-2-[4-(oxan-2-ylmethoxy)phenyl]sulfanylpyrimidine |
|---|---|
| PubChem CID | 3327394 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4,6-dimethyl-2-[4-(oxan-2-ylmethoxy)phenyl]sulfanylpyrimidine |
| SMILES | Cc1cc(C)nc(Sc2ccc(OCC3CCCCO3)cc2)n1 |
| InChI | InChI=1S/C18H22N2O2S/c1-13-11-14(2)20-18(19-13)23-17-8-6-15(7-9-17)22-12-16-5-3-4-10-21-16/h6-9,11,16H,3-5,10,12H2,1-2H3 |
| InChIKey | WZDHEQFYCMQCEG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |