C13H16N2O3 — CID 142960191
6-methyl-2-(oxan-2-ylmethoxy)furo[2,3-d]pyrimidine (PubChem CID 142960191) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 6-methyl-2-(oxan-2-ylmethoxy)furo[2,3-d]pyrimidine.
| Compound Name | 6-methyl-2-(oxan-2-ylmethoxy)furo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 142960191 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 6-methyl-2-(oxan-2-ylmethoxy)furo[2,3-d]pyrimidine |
| SMILES | Cc1cc2cnc(OCC3CCCCO3)nc2o1 |
| InChI | InChI=1S/C13H16N2O3/c1-9-6-10-7-14-13(15-12(10)18-9)17-8-11-4-2-3-5-16-11/h6-7,11H,2-5,8H2,1H3 |
| InChIKey | RNZNANDNKFSVER-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |