C16H20N2O2 — CID 102713794
3-methyl-5-(oxan-2-ylmethoxy)isoquinolin-8-amine (PubChem CID 102713794) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-methyl-5-(oxan-2-ylmethoxy)isoquinolin-8-amine.
| Compound Name | 3-methyl-5-(oxan-2-ylmethoxy)isoquinolin-8-amine |
|---|---|
| PubChem CID | 102713794 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-methyl-5-(oxan-2-ylmethoxy)isoquinolin-8-amine |
| SMILES | Cc1cc2c(OCC3CCCCO3)ccc(N)c2cn1 |
| InChI | InChI=1S/C16H20N2O2/c1-11-8-13-14(9-18-11)15(17)5-6-16(13)20-10-12-4-2-3-7-19-12/h5-6,8-9,12H,2-4,7,10,17H2,1H3 |
| InChIKey | HZTZWRPGAQCFMB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|