C18H24N2O — CID 102713907
5-(4,4-dimethylcyclohexyl)oxy-3-methylisoquinolin-8-amine (PubChem CID 102713907) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 5-(4,4-dimethylcyclohexyl)oxy-3-methylisoquinolin-8-amine.
| Compound Name | 5-(4,4-dimethylcyclohexyl)oxy-3-methylisoquinolin-8-amine |
|---|---|
| PubChem CID | 102713907 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 5-(4,4-dimethylcyclohexyl)oxy-3-methylisoquinolin-8-amine |
| SMILES | Cc1cc2c(OC3CCC(C)(C)CC3)ccc(N)c2cn1 |
| InChI | InChI=1S/C18H24N2O/c1-12-10-14-15(11-20-12)16(19)4-5-17(14)21-13-6-8-18(2,3)9-7-13/h4-5,10-11,13H,6-9,19H2,1-3H3 |
| InChIKey | CKFITFUHLMEJNC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|