C23H20F3NO4 — CID 139254285
(4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-one (PubChem CID 139254285) has the molecular formula C23H20F3NO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is (4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 139254285 |
| Molecular Formula | C23H20F3NO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (4Z)-4-[[4-(oxan-2-ylmethoxy)phenyl]methylidene]-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccc(C(F)(F)F)cc2)/C1=C/c1ccc(OCC2CCCCO2)cc1 |
| InChI | InChI=1S/C23H20F3NO4/c24-23(25,26)17-8-6-16(7-9-17)21-20(22(28)31-27-21)13-15-4-10-18(11-5-15)30-14-19-3-1-2-12-29-19/h4-11,13,19H,1-3,12,14H2/b20-13- |
| InChIKey | ZXZLXMVYBVJCJA-MOSHPQCFSA-N |
| XLogP | 5.00 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|