C25H24N2O — CID 90551907
N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2,2-diphenylacetamide (PubChem CID 90551907) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 90551907 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]prop-2-ynyl]-2,2-diphenylacetamide |
| SMILES | CN(C)c1ccc(C#CCNC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O/c1-27(2)23-17-15-20(16-18-23)10-9-19-26-25(28)24(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-8,11-18,24H,19H2,1-2H3,(H,26,28) |
| InChIKey | DTXOBHYZEOBNFZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|